C14H25NO2 — CID 19361927
2-[11-(aminomethyl)-11-bicyclo[4.4.1]undecanyl]acetic acid (PubChem CID 19361927) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-[11-(aminomethyl)-11-bicyclo[4.4.1]undecanyl]acetic acid.
| Compound Name | 2-[11-(aminomethyl)-11-bicyclo[4.4.1]undecanyl]acetic acid |
|---|---|
| PubChem CID | 19361927 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 2-[11-(aminomethyl)-11-bicyclo[4.4.1]undecanyl]acetic acid |
| SMILES | NCC1(CC(=O)O)C2CCCCC1CCCC2 |
| InChI | InChI=1S/C14H25NO2/c15-10-14(9-13(16)17)11-5-1-2-6-12(14)8-4-3-7-11/h11-12H,1-10,15H2,(H,16,17) |
| InChIKey | JHTQKYFMBLXAOV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |