C13H18F3NO2 — CID 134355840
2-[(1R,2R,3S,6S,7S,8R)-2-(aminomethyl)-7-(trifluoromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid (PubChem CID 134355840) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-[(1R,2R,3S,6S,7S,8R)-2-(aminomethyl)-7-(trifluoromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid.
| Compound Name | 2-[(1R,2R,3S,6S,7S,8R)-2-(aminomethyl)-7-(trifluoromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid |
|---|---|
| PubChem CID | 134355840 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[(1R,2R,3S,6S,7S,8R)-2-(aminomethyl)-7-(trifluoromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid |
| SMILES | NC[C@@]1(CC(=O)O)[C@@H]2C[C@@H]3CC[C@H]1[C@H]2[C@H]3C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO2/c14-13(15,16)11-6-1-2-7-10(11)8(3-6)12(7,5-17)4-9(18)19/h6-8,10-11H,1-5,17H2,(H,18,19)/t6-,7-,8+,10+,11-,12+/m0/s1 |
| InChIKey | HDJAMPWYIBKVDE-FBENFUAYSA-N |
| XLogP | 2.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |