About 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid
2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid (PubChem CID 134355854) has the molecular formula C14H22FNO2
and a molecular weight of 255.33 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid |
| PubChem CID | 134355854 |
| Molecular Formula | C14H22FNO2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid |
| SMILES | CC(F)C1C2CCC3C1C(C2)C3(CN)CC(=O)O |
| InChI | InChI=1S/C14H22FNO2/c1-7(15)12-8-2-3-9-13(12)10(4-8)14(9,6-16)5-11(17)18/h7-10,12-13H,2-6,16H2,1H3,(H,17,18) |
| InChIKey | WMKNKNNYJRHZJB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid?
The IUPAC name of 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid (CID 134355854) is 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid.
What is the SMILES notation for 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid?
The canonical SMILES for 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid is CC(F)C1C2CCC3C1C(C2)C3(CN)CC(=O)O.
What is the InChIKey of 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid?
The InChIKey is WMKNKNNYJRHZJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FNO2/c1-7(15)12-8-2-3-9-13(12)10(4-8)14(9,6-16)5-11(17)18/h7-10,12-13H,2-6,16H2,1H3,(H,17,18).
What are the key properties of 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid?
2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid has a molecular weight of 255.33 g/mol, XLogP of 2.06, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(aminomethyl)-7-(1-fluoroethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid is sourced from PubChem (CID 134355854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).