C15H21NO2 — CID 142304137
2-[(1S,2R,3R,7S,10R)-2-(aminomethyl)-7-ethenyl-2-tricyclo[4.3.1.03,10]dec-5-enyl]acetic acid (PubChem CID 142304137) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[(1S,2R,3R,7S,10R)-2-(aminomethyl)-7-ethenyl-2-tricyclo[4.3.1.03,10]dec-5-enyl]acetic acid.
| Compound Name | 2-[(1S,2R,3R,7S,10R)-2-(aminomethyl)-7-ethenyl-2-tricyclo[4.3.1.03,10]dec-5-enyl]acetic acid |
|---|---|
| PubChem CID | 142304137 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-[(1S,2R,3R,7S,10R)-2-(aminomethyl)-7-ethenyl-2-tricyclo[4.3.1.03,10]dec-5-enyl]acetic acid |
| SMILES | C=C[C@@H]1CC[C@H]2[C@H]3C1=CC[C@H]3[C@@]2(CN)CC(=O)O |
| InChI | InChI=1S/C15H21NO2/c1-2-9-3-5-11-14-10(9)4-6-12(14)15(11,8-16)7-13(17)18/h2,4,9,11-12,14H,1,3,5-8,16H2,(H,17,18)/t9-,11+,12-,14-,15-/m1/s1 |
| InChIKey | QSHFOBXDIRBNMB-FJZRYDKGSA-N |
| XLogP | 2.19 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|