C16H13ClF5N5O2 — CID 149130270
8-chloro-12,12-difluoro-14-methyl-5-[3-(trifluoromethoxy)phenyl]-10-oxa-3,4,6,7,14-pentazatricyclo[7.5.0.02,6]tetradeca-1(9),4,7-triene (PubChem CID 149130270) has the molecular formula C16H13ClF5N5O2 and a molecular weight of 437.76 g/mol. Its IUPAC name is 8-chloro-12,12-difluoro-14-methyl-5-[3-(trifluoromethoxy)phenyl]-10-oxa-3,4,6,7,14-pentazatricyclo[7.5.0.02,6]tetradeca-1(9),4,7-triene.
| Compound Name | 8-chloro-12,12-difluoro-14-methyl-5-[3-(trifluoromethoxy)phenyl]-10-oxa-3,4,6,7,14-pentazatricyclo[7.5.0.02,6]tetradeca-1(9),4,7-triene |
|---|---|
| PubChem CID | 149130270 |
| Molecular Formula | C16H13ClF5N5O2 |
| Molecular Weight | 437.76 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 8-chloro-12,12-difluoro-14-methyl-5-[3-(trifluoromethoxy)phenyl]-10-oxa-3,4,6,7,14-pentazatricyclo[7.5.0.02,6]tetradeca-1(9),4,7-triene |
| SMILES | CN1CC(F)(F)COC2=C1C1NN=C(c3cccc(OC(F)(F)F)c3)N1N=C2Cl |
| InChI | InChI=1S/C16H13ClF5N5O2/c1-26-6-15(18,19)7-28-11-10(26)14-24-23-13(27(14)25-12(11)17)8-3-2-4-9(5-8)29-16(20,21)22/h2-5,14,24H,6-7H2,1H3 |
| InChIKey | RCISTQXNUZPWSX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |