C17H19N2O4+ — CID 149134584
1,3-bis(2-methoxyethyl)benzo[f]benzimidazol-3-ium-4,9-dione (PubChem CID 149134584) has the molecular formula C17H19N2O4+ and a molecular weight of 315.35 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethyl)benzo[f]benzimidazol-3-ium-4,9-dione.
| Compound Name | 1,3-bis(2-methoxyethyl)benzo[f]benzimidazol-3-ium-4,9-dione |
|---|---|
| PubChem CID | 149134584 |
| Molecular Formula | C17H19N2O4+ |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1,3-bis(2-methoxyethyl)benzo[f]benzimidazol-3-ium-4,9-dione |
| SMILES | COCCn1c[n+](CCOC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H19N2O4/c1-22-9-7-18-11-19(8-10-23-2)15-14(18)16(20)12-5-3-4-6-13(12)17(15)21/h3-6,11H,7-10H2,1-2H3/q+1 |
| InChIKey | RDUYQHYYUPYOCS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|