5-cyano-6-methoxy-4,6-dioxohexanoic acid

C8H9NO5 — CID 14913968

IUPAC5-cyano-6-methoxy-4,6-dioxohexanoic acid
SMILESCOC(=O)C(C#N)C(=O)CCC(=O)O
InChIInChI=1S/C8H9NO5/c1-14-8(13)5(4-9)6(10)2-3-7(11)12/h5H,2-3H2,1H3,(H,11,12)
InChIKeyGANZBQPRVKWZBA-UHFFFAOYSA-N
MW199.16 g/mol
LogP-0.27
Rot. Bonds5

About 5-cyano-6-methoxy-4,6-dioxohexanoic acid

5-cyano-6-methoxy-4,6-dioxohexanoic acid (PubChem CID 14913968) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is 5-cyano-6-methoxy-4,6-dioxohexanoic acid.

Molecular Properties

Compound Name5-cyano-6-methoxy-4,6-dioxohexanoic acid
PubChem CID14913968
Molecular FormulaC8H9NO5
Molecular Weight199.16 g/mol
Exact Mass199.05
IUPAC Name5-cyano-6-methoxy-4,6-dioxohexanoic acid
SMILESCOC(=O)C(C#N)C(=O)CCC(=O)O
InChIInChI=1S/C8H9NO5/c1-14-8(13)5(4-9)6(10)2-3-7(11)12/h5H,2-3H2,1H3,(H,11,12)
InChIKeyGANZBQPRVKWZBA-UHFFFAOYSA-N
XLogP-0.27
TPSA104.46 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.16
LogP ≤ 5-0.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 5-cyano-6-methoxy-4,6-dioxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-cyano-6-methoxy-4,6-dioxohexanoic acid?
The IUPAC name of 5-cyano-6-methoxy-4,6-dioxohexanoic acid (CID 14913968) is 5-cyano-6-methoxy-4,6-dioxohexanoic acid.
What is the SMILES notation for 5-cyano-6-methoxy-4,6-dioxohexanoic acid?
The canonical SMILES for 5-cyano-6-methoxy-4,6-dioxohexanoic acid is COC(=O)C(C#N)C(=O)CCC(=O)O.
What is the InChIKey of 5-cyano-6-methoxy-4,6-dioxohexanoic acid?
The InChIKey is GANZBQPRVKWZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO5/c1-14-8(13)5(4-9)6(10)2-3-7(11)12/h5H,2-3H2,1H3,(H,11,12).
What are the key properties of 5-cyano-6-methoxy-4,6-dioxohexanoic acid?
5-cyano-6-methoxy-4,6-dioxohexanoic acid has a molecular weight of 199.16 g/mol, XLogP of -0.27, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-6-methoxy-4,6-dioxohexanoic acid is sourced from PubChem (CID 14913968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).