C16H21F13OSi — CID 14914244
[(E)-5-ethyl-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundec-3-en-4-yl]oxy-trimethylsilane (PubChem CID 14914244) has the molecular formula C16H21F13OSi and a molecular weight of 504.40 g/mol. Its IUPAC name is [(E)-5-ethyl-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundec-3-en-4-yl]oxy-trimethylsilane.
| Compound Name | [(E)-5-ethyl-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundec-3-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 14914244 |
| Molecular Formula | C16H21F13OSi |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | [(E)-5-ethyl-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundec-3-en-4-yl]oxy-trimethylsilane |
| SMILES | CC/C=C(/O[Si](C)(C)C)C(CC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H21F13OSi/c1-6-8-10(30-31(3,4)5)9(7-2)11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h8-9H,6-7H2,1-5H3/b10-8+ |
| InChIKey | BEDPMPWQJSATMH-CSKARUKUSA-N |
| XLogP | 7.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|