C9H12N2 — CID 149143025
N-[(Z)-but-2-en-2-yl]-3-methylidenepyrrol-2-amine (PubChem CID 149143025) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-3-methylidenepyrrol-2-amine.
| Compound Name | N-[(Z)-but-2-en-2-yl]-3-methylidenepyrrol-2-amine |
|---|---|
| PubChem CID | 149143025 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-3-methylidenepyrrol-2-amine |
| SMILES | C=C1C=CN=C1N/C(C)=C\C |
| InChI | InChI=1S/C9H12N2/c1-4-8(3)11-9-7(2)5-6-10-9/h4-6H,2H2,1,3H3,(H,10,11)/b8-4- |
| InChIKey | RIMSPJZVOAGJIP-YWEYNIOJSA-N |
| XLogP | 1.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |