About N-hydrazinylnitramide
N-hydrazinylnitramide (PubChem CID 149151955) has the molecular formula H4N4O2
and a molecular weight of 92.06 g/mol. Its IUPAC name is N-hydrazinylnitramide.
Molecular Properties
| Compound Name | N-hydrazinylnitramide |
| PubChem CID | 149151955 |
| Molecular Formula | H4N4O2 |
| Molecular Weight | 92.06 g/mol |
| Exact Mass | 92.03 |
| IUPAC Name | N-hydrazinylnitramide |
| SMILES | NNN[N+](=O)[O-] |
| InChI | InChI=1S/H4N4O2/c1-2-3-4(5)6/h2-3H,1H2 |
| InChIKey | JHKPPUKSLOYWRN-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.06 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydrazinylnitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydrazinylnitramide?
The IUPAC name of N-hydrazinylnitramide (CID 149151955) is N-hydrazinylnitramide.
What is the SMILES notation for N-hydrazinylnitramide?
The canonical SMILES for N-hydrazinylnitramide is NNN[N+](=O)[O-].
What is the InChIKey of N-hydrazinylnitramide?
The InChIKey is JHKPPUKSLOYWRN-UHFFFAOYSA-N. The full InChI is InChI=1S/H4N4O2/c1-2-3-4(5)6/h2-3H,1H2.
What are the key properties of N-hydrazinylnitramide?
N-hydrazinylnitramide has a molecular weight of 92.06 g/mol, XLogP of -1.85, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydrazinylnitramide is sourced from PubChem (CID 149151955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).