About nitric hydrazide
nitric hydrazide (PubChem CID 18347975) has the molecular formula H3N3O2
and a molecular weight of 77.04 g/mol. Its IUPAC name is nitric hydrazide.
Molecular Properties
| Compound Name | nitric hydrazide |
| PubChem CID | 18347975 |
| Molecular Formula | H3N3O2 |
| Molecular Weight | 77.04 g/mol |
| Exact Mass | 77.02 |
| IUPAC Name | nitric hydrazide |
| SMILES | NN[N+](=O)[O-] |
| InChI | InChI=1S/H3N3O2/c1-2-3(4)5/h2H,1H2 |
| InChIKey | ZXDZVVSOWQEMOD-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.04 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitric hydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitric hydrazide?
The IUPAC name of nitric hydrazide (CID 18347975) is nitric hydrazide.
What is the SMILES notation for nitric hydrazide?
The canonical SMILES for nitric hydrazide is NN[N+](=O)[O-].
What is the InChIKey of nitric hydrazide?
The InChIKey is ZXDZVVSOWQEMOD-UHFFFAOYSA-N. The full InChI is InChI=1S/H3N3O2/c1-2-3(4)5/h2H,1H2.
What are the key properties of nitric hydrazide?
nitric hydrazide has a molecular weight of 77.04 g/mol, XLogP of -1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitric hydrazide is sourced from PubChem (CID 18347975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).