About nitro(oxido)azanium
nitro(oxido)azanium (PubChem CID 58001803) has the molecular formula H2N2O3
and a molecular weight of 78.03 g/mol. Its IUPAC name is nitro(oxido)azanium.
Molecular Properties
| Compound Name | nitro(oxido)azanium |
| PubChem CID | 58001803 |
| Molecular Formula | H2N2O3 |
| Molecular Weight | 78.03 g/mol |
| Exact Mass | 78.01 |
| IUPAC Name | nitro(oxido)azanium |
| SMILES | O=[N+]([O-])[NH2+][O-] |
| InChI | InChI=1S/H2N2O3/c3-1-2(4)5/h1H2 |
| InChIKey | KVKGYNYSUPXPRQ-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.03 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitro(oxido)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro(oxido)azanium?
The IUPAC name of nitro(oxido)azanium (CID 58001803) is nitro(oxido)azanium.
What is the SMILES notation for nitro(oxido)azanium?
The canonical SMILES for nitro(oxido)azanium is O=[N+]([O-])[NH2+][O-].
What is the InChIKey of nitro(oxido)azanium?
The InChIKey is KVKGYNYSUPXPRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N2O3/c3-1-2(4)5/h1H2.
What are the key properties of nitro(oxido)azanium?
nitro(oxido)azanium has a molecular weight of 78.03 g/mol, XLogP of -1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitro(oxido)azanium is sourced from PubChem (CID 58001803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).