About nitramide
nitramide (PubChem CID 24534) has the molecular formula H2N2O2
and a molecular weight of 62.03 g/mol. Its IUPAC name is nitramide.
Molecular Properties
| Compound Name | nitramide |
| PubChem CID | 24534 |
| Molecular Formula | H2N2O2 |
| Molecular Weight | 62.03 g/mol |
| Exact Mass | 62.01 |
| IUPAC Name | nitramide |
| SMILES | N[N+](=O)[O-] |
| InChI | InChI=1S/H2N2O2/c1-2(3)4/h1H2 |
| InChIKey | SFDJOSRHYKHMOK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 62.03 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitramide?
The IUPAC name of nitramide (CID 24534) is nitramide.
What is the SMILES notation for nitramide?
The canonical SMILES for nitramide is N[N+](=O)[O-].
What is the InChIKey of nitramide?
The InChIKey is SFDJOSRHYKHMOK-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N2O2/c1-2(3)4/h1H2.
What are the key properties of nitramide?
nitramide has a molecular weight of 62.03 g/mol, XLogP of -0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nitramide is sourced from PubChem (CID 24534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).