C20H28O4 — CID 14915683
ethyl (2S)-2-benzyl-3-[(1S,2S)-2-hydroxycyclohexyl]oxy-2-methylbut-3-enoate (PubChem CID 14915683) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is ethyl (2S)-2-benzyl-3-[(1S,2S)-2-hydroxycyclohexyl]oxy-2-methylbut-3-enoate.
| Compound Name | ethyl (2S)-2-benzyl-3-[(1S,2S)-2-hydroxycyclohexyl]oxy-2-methylbut-3-enoate |
|---|---|
| PubChem CID | 14915683 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | ethyl (2S)-2-benzyl-3-[(1S,2S)-2-hydroxycyclohexyl]oxy-2-methylbut-3-enoate |
| SMILES | C=C(O[C@H]1CCCC[C@@H]1O)[C@](C)(Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C20H28O4/c1-4-23-19(22)20(3,14-16-10-6-5-7-11-16)15(2)24-18-13-9-8-12-17(18)21/h5-7,10-11,17-18,21H,2,4,8-9,12-14H2,1,3H3/t17-,18-,20-/m0/s1 |
| InChIKey | SQPNFVQTGLZEOH-BJLQDIEVSA-N |
| XLogP | 3.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|