C17H30O5 — CID 91133199
ethyl prop-2-enoate;(2-hydroxycyclohexyl) 2,2-dimethylbutanoate (PubChem CID 91133199) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is ethyl prop-2-enoate;(2-hydroxycyclohexyl) 2,2-dimethylbutanoate.
| Compound Name | ethyl prop-2-enoate;(2-hydroxycyclohexyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91133199 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | ethyl prop-2-enoate;(2-hydroxycyclohexyl) 2,2-dimethylbutanoate |
| SMILES | C=CC(=O)OCC.CCC(C)(C)C(=O)OC1CCCCC1O |
| InChI | InChI=1S/C12H22O3.C5H8O2/c1-4-12(2,3)11(14)15-10-8-6-5-7-9(10)13;1-3-5(6)7-4-2/h9-10,13H,4-8H2,1-3H3;3H,1,4H2,2H3 |
| InChIKey | KEOLCCOKMDENIH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|