C16H28O5 — CID 59672467
[2-hydroxy-4-(prop-2-enylperoxymethyl)cyclohexyl] 2,2-dimethylbutanoate (PubChem CID 59672467) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is [2-hydroxy-4-(prop-2-enylperoxymethyl)cyclohexyl] 2,2-dimethylbutanoate.
| Compound Name | [2-hydroxy-4-(prop-2-enylperoxymethyl)cyclohexyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59672467 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | [2-hydroxy-4-(prop-2-enylperoxymethyl)cyclohexyl] 2,2-dimethylbutanoate |
| SMILES | C=CCOOCC1CCC(OC(=O)C(C)(C)CC)C(O)C1 |
| InChI | InChI=1S/C16H28O5/c1-5-9-19-20-11-12-7-8-14(13(17)10-12)21-15(18)16(3,4)6-2/h5,12-14,17H,1,6-11H2,2-4H3 |
| InChIKey | NOWBFJQLQUJJCB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|