C19H30O7 — CID 58067967
[3-[2-hydroxy-4-(2-methylprop-2-enoyloxy)cyclohexyl]oxy-3-oxopropyl] 2,2-dimethylbutanoate (PubChem CID 58067967) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is [3-[2-hydroxy-4-(2-methylprop-2-enoyloxy)cyclohexyl]oxy-3-oxopropyl] 2,2-dimethylbutanoate.
| Compound Name | [3-[2-hydroxy-4-(2-methylprop-2-enoyloxy)cyclohexyl]oxy-3-oxopropyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58067967 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [3-[2-hydroxy-4-(2-methylprop-2-enoyloxy)cyclohexyl]oxy-3-oxopropyl] 2,2-dimethylbutanoate |
| SMILES | C=C(C)C(=O)OC1CCC(OC(=O)CCOC(=O)C(C)(C)CC)C(O)C1 |
| InChI | InChI=1S/C19H30O7/c1-6-19(4,5)18(23)24-10-9-16(21)26-15-8-7-13(11-14(15)20)25-17(22)12(2)3/h13-15,20H,2,6-11H2,1,3-5H3 |
| InChIKey | TYCBYWCDIZESOX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|