C17H24O6 — CID 59440516
3-[3-(2,2-dimethylbutanoyloxy)propanoyloxy]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 59440516) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylbutanoyloxy)propanoyloxy]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[3-(2,2-dimethylbutanoyloxy)propanoyloxy]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 59440516 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-[3-(2,2-dimethylbutanoyloxy)propanoyloxy]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)OCCC(=O)OC1C2C=CC(C2)C1C(=O)O |
| InChI | InChI=1S/C17H24O6/c1-4-17(2,3)16(21)22-8-7-12(18)23-14-11-6-5-10(9-11)13(14)15(19)20/h5-6,10-11,13-14H,4,7-9H2,1-3H3,(H,19,20) |
| InChIKey | MHORAOCXSZZBCC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|