C18H28O6 — CID 20761279
2-(2,2-dimethylbutanoyloxy)ethyl 3-(hydroperoxymethyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 20761279) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl 3-(hydroperoxymethyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl 3-(hydroperoxymethyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 20761279 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl 3-(hydroperoxymethyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C1C2C=CC(CC2)C1COO |
| InChI | InChI=1S/C18H28O6/c1-4-18(2,3)17(20)23-10-9-22-16(19)15-13-7-5-12(6-8-13)14(15)11-24-21/h5,7,12-15,21H,4,6,8-11H2,1-3H3 |
| InChIKey | MPZYHQLMQQQESD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|