C15H26O5 — CID 91552428
ethene;[4-(formyloxymethyl)-2-hydroxycyclohexyl] 2-methylbutanoate (PubChem CID 91552428) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is ethene;[4-(formyloxymethyl)-2-hydroxycyclohexyl] 2-methylbutanoate.
| Compound Name | ethene;[4-(formyloxymethyl)-2-hydroxycyclohexyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 91552428 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | ethene;[4-(formyloxymethyl)-2-hydroxycyclohexyl] 2-methylbutanoate |
| SMILES | C=C.CCC(C)C(=O)OC1CCC(COC=O)CC1O |
| InChI | InChI=1S/C13H22O5.C2H4/c1-3-9(2)13(16)18-12-5-4-10(6-11(12)15)7-17-8-14;1-2/h8-12,15H,3-7H2,1-2H3;1-2H2 |
| InChIKey | UTEDDAICTAQHPS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|