C15H26O2 — CID 123408529
(2-ethyl-3,5-dimethylcyclohex-3-en-1-yl) 2-methylbutanoate (PubChem CID 123408529) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2-ethyl-3,5-dimethylcyclohex-3-en-1-yl) 2-methylbutanoate.
| Compound Name | (2-ethyl-3,5-dimethylcyclohex-3-en-1-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 123408529 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2-ethyl-3,5-dimethylcyclohex-3-en-1-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C(C)C1CC |
| InChI | InChI=1S/C15H26O2/c1-6-11(4)15(16)17-14-9-10(3)8-12(5)13(14)7-2/h8,10-11,13-14H,6-7,9H2,1-5H3 |
| InChIKey | LHAXJPTZMJJUSK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|