C19H32O2 — CID 173200428
(3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2-methylbutanoate;ethane (PubChem CID 173200428) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2-methylbutanoate;ethane.
| Compound Name | (3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2-methylbutanoate;ethane |
|---|---|
| PubChem CID | 173200428 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2-methylbutanoate;ethane |
| SMILES | CC.CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)CC21 |
| InChI | InChI=1S/C17H26O2.C2H6/c1-5-13(4)17(18)19-16-10-12(3)8-14-7-6-11(2)9-15(14)16;1-2/h6-8,11-13,15-16H,5,9-10H2,1-4H3;1-2H3 |
| InChIKey | LGRMWNCOSOCUQQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |