C13H20ClN5O2 — CID 149158648
[6-chloro-5-(ethylamino)-3-methoxypyrazin-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 149158648) has the molecular formula C13H20ClN5O2 and a molecular weight of 313.79 g/mol. Its IUPAC name is [6-chloro-5-(ethylamino)-3-methoxypyrazin-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [6-chloro-5-(ethylamino)-3-methoxypyrazin-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 149158648 |
| Molecular Formula | C13H20ClN5O2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [6-chloro-5-(ethylamino)-3-methoxypyrazin-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CCNc1nc(OC)c(C(=O)N2CCN(C)CC2)nc1Cl |
| InChI | InChI=1S/C13H20ClN5O2/c1-4-15-11-10(14)16-9(12(17-11)21-3)13(20)19-7-5-18(2)6-8-19/h4-8H2,1-3H3,(H,15,17) |
| InChIKey | AIHDGBWVIWKOFU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |