C19H18N2O — CID 14916565
2-ethyl-5,11-dimethyl-1,6-dihydropyrido[3,2-b]carbazol-4-one (PubChem CID 14916565) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-ethyl-5,11-dimethyl-1,6-dihydropyrido[3,2-b]carbazol-4-one.
| Compound Name | 2-ethyl-5,11-dimethyl-1,6-dihydropyrido[3,2-b]carbazol-4-one |
|---|---|
| PubChem CID | 14916565 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-ethyl-5,11-dimethyl-1,6-dihydropyrido[3,2-b]carbazol-4-one |
| SMILES | CCc1cc(=O)c2c(C)c3[nH]c4ccccc4c3c(C)c2[nH]1 |
| InChI | InChI=1S/C19H18N2O/c1-4-12-9-15(22)17-11(3)18-16(10(2)19(17)20-12)13-7-5-6-8-14(13)21-18/h5-9,21H,4H2,1-3H3,(H,20,22) |
| InChIKey | CFHOPBFSTWVUBE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |