C19H23NO2 — CID 149165816
[(3S)-3-[(2S)-2-naphthalen-1-ylpropyl]pyrrolidin-1-yl]methyl formate (PubChem CID 149165816) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is [(3S)-3-[(2S)-2-naphthalen-1-ylpropyl]pyrrolidin-1-yl]methyl formate.
| Compound Name | [(3S)-3-[(2S)-2-naphthalen-1-ylpropyl]pyrrolidin-1-yl]methyl formate |
|---|---|
| PubChem CID | 149165816 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [(3S)-3-[(2S)-2-naphthalen-1-ylpropyl]pyrrolidin-1-yl]methyl formate |
| SMILES | C[C@@H](C[C@H]1CCN(COC=O)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H23NO2/c1-15(11-16-9-10-20(12-16)13-22-14-21)18-8-4-6-17-5-2-3-7-19(17)18/h2-8,14-16H,9-13H2,1H3/t15-,16+/m0/s1 |
| InChIKey | WYBUKODIRMMWQC-JKSUJKDBSA-N |
| XLogP | 3.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|