C37H35N5 — CID 157304467
5-[(3S)-3-[(2S)-2-naphthalen-1-ylpropyl]pyrrolidin-1-yl]-2-trityltetrazole (PubChem CID 157304467) has the molecular formula C37H35N5 and a molecular weight of 549.72 g/mol. Its IUPAC name is 5-[(3S)-3-[(2S)-2-naphthalen-1-ylpropyl]pyrrolidin-1-yl]-2-trityltetrazole.
| Compound Name | 5-[(3S)-3-[(2S)-2-naphthalen-1-ylpropyl]pyrrolidin-1-yl]-2-trityltetrazole |
|---|---|
| PubChem CID | 157304467 |
| Molecular Formula | C37H35N5 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 5-[(3S)-3-[(2S)-2-naphthalen-1-ylpropyl]pyrrolidin-1-yl]-2-trityltetrazole |
| SMILES | C[C@@H](C[C@H]1CCN(c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C37H35N5/c1-28(34-23-13-15-30-14-11-12-22-35(30)34)26-29-24-25-41(27-29)36-38-40-42(39-36)37(31-16-5-2-6-17-31,32-18-7-3-8-19-32)33-20-9-4-10-21-33/h2-23,28-29H,24-27H2,1H3/t28-,29+/m0/s1 |
| InChIKey | LJNRNPRKIGRIAJ-URLMMPGGSA-N |
| XLogP | 7.69 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|