C7H12F3NO — CID 149178234
(3R,4S,5S)-3-methyl-5-(trifluoromethyl)piperidin-4-ol (PubChem CID 149178234) has the molecular formula C7H12F3NO and a molecular weight of 183.17 g/mol. Its IUPAC name is (3R,4S,5S)-3-methyl-5-(trifluoromethyl)piperidin-4-ol.
| Compound Name | (3R,4S,5S)-3-methyl-5-(trifluoromethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 149178234 |
| Molecular Formula | C7H12F3NO |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (3R,4S,5S)-3-methyl-5-(trifluoromethyl)piperidin-4-ol |
| SMILES | C[C@@H]1CNC[C@H](C(F)(F)F)[C@H]1O |
| InChI | InChI=1S/C7H12F3NO/c1-4-2-11-3-5(6(4)12)7(8,9)10/h4-6,11-12H,2-3H2,1H3/t4-,5+,6+/m1/s1 |
| InChIKey | XAKVVDLXCXOJAW-SRQIZXRXSA-N |
| XLogP | 0.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |