C16H14O2S — CID 14918121
methyl 3-(4-phenylbut-1-ynyl)thiophene-2-carboxylate (PubChem CID 14918121) has the molecular formula C16H14O2S and a molecular weight of 270.35 g/mol. Its IUPAC name is methyl 3-(4-phenylbut-1-ynyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(4-phenylbut-1-ynyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 14918121 |
| Molecular Formula | C16H14O2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | methyl 3-(4-phenylbut-1-ynyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1C#CCCc1ccccc1 |
| InChI | InChI=1S/C16H14O2S/c1-18-16(17)15-14(11-12-19-15)10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8,11-12H,5,9H2,1H3 |
| InChIKey | LLOIMUUAOHIYEQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|