C15H17F3NO2+ — CID 149201024
[1-[4-(2,2-dimethylpropanoyl)phenyl]-4,4,4-trifluoro-3-oxobut-1-enyl]azanium (PubChem CID 149201024) has the molecular formula C15H17F3NO2+ and a molecular weight of 300.30 g/mol. Its IUPAC name is [1-[4-(2,2-dimethylpropanoyl)phenyl]-4,4,4-trifluoro-3-oxobut-1-enyl]azanium.
| Compound Name | [1-[4-(2,2-dimethylpropanoyl)phenyl]-4,4,4-trifluoro-3-oxobut-1-enyl]azanium |
|---|---|
| PubChem CID | 149201024 |
| Molecular Formula | C15H17F3NO2+ |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [1-[4-(2,2-dimethylpropanoyl)phenyl]-4,4,4-trifluoro-3-oxobut-1-enyl]azanium |
| SMILES | CC(C)(C)C(=O)c1ccc(C([NH3+])=CC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NO2/c1-14(2,3)13(21)10-6-4-9(5-7-10)11(19)8-12(20)15(16,17)18/h4-8H,19H2,1-3H3/p+1 |
| InChIKey | QLHLMIHHBPZWRL-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|