C41H50N2O7 — CID 149220259
(2S,4R)-1-[(2R)-2-[2-(2,2-dimethylpent-4-enoxy)-2-oxoethyl]non-8-enoyl]-4-(6-ethenyl-7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-2-carboxylic acid (PubChem CID 149220259) has the molecular formula C41H50N2O7 and a molecular weight of 682.86 g/mol. Its IUPAC name is (2S,4R)-1-[(2R)-2-[2-(2,2-dimethylpent-4-enoxy)-2-oxoethyl]non-8-enoyl]-4-(6-ethenyl-7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-[(2R)-2-[2-(2,2-dimethylpent-4-enoxy)-2-oxoethyl]non-8-enoyl]-4-(6-ethenyl-7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 149220259 |
| Molecular Formula | C41H50N2O7 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.36 |
| IUPAC Name | (2S,4R)-1-[(2R)-2-[2-(2,2-dimethylpent-4-enoxy)-2-oxoethyl]non-8-enoyl]-4-(6-ethenyl-7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-2-carboxylic acid |
| SMILES | C=CCCCCC[C@H](CC(=O)OCC(C)(C)CC=C)C(=O)N1C[C@H](Oc2cc(-c3ccccc3)nc3cc(OC)c(C=C)cc23)C[C@H]1C(=O)O |
| InChI | InChI=1S/C41H50N2O7/c1-7-10-11-12-14-19-30(22-38(44)49-27-41(4,5)20-8-2)39(45)43-26-31(23-35(43)40(46)47)50-37-24-33(29-17-15-13-16-18-29)42-34-25-36(48-6)28(9-3)21-32(34)37/h7-9,13,15-18,21,24-25,30-31,35H,1-3,10-12,14,19-20,22-23,26-27H2,4-6H3,(H,46,47)/t30-,31-,35+/m1/s1 |
| InChIKey | XIHNOQBKEUPQJQ-MCQSSSDPSA-N |
| XLogP | 8.27 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|