C23H20N2O5 — CID 69085209
(2S,4R)-4-(6-ethenyl-2-phenylquinolin-4-yl)oxypyrrolidine-1,2-dicarboxylic acid (PubChem CID 69085209) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is (2S,4R)-4-(6-ethenyl-2-phenylquinolin-4-yl)oxypyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4R)-4-(6-ethenyl-2-phenylquinolin-4-yl)oxypyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 69085209 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S,4R)-4-(6-ethenyl-2-phenylquinolin-4-yl)oxypyrrolidine-1,2-dicarboxylic acid |
| SMILES | C=Cc1ccc2nc(-c3ccccc3)cc(O[C@@H]3C[C@@H](C(=O)O)N(C(=O)O)C3)c2c1 |
| InChI | InChI=1S/C23H20N2O5/c1-2-14-8-9-18-17(10-14)21(12-19(24-18)15-6-4-3-5-7-15)30-16-11-20(22(26)27)25(13-16)23(28)29/h2-10,12,16,20H,1,11,13H2,(H,26,27)(H,28,29)/t16-,20+/m1/s1 |
| InChIKey | KRIZGSMVHMYDDH-UZLBHIALSA-N |
| XLogP | 4.13 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |