About ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+)
ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+) (PubChem CID 149229178) has the molecular formula C11H21NW
and a molecular weight of 351.14 g/mol. Its IUPAC name is ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+).
Molecular Properties
| Compound Name | ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+) |
| PubChem CID | 149229178 |
| Molecular Formula | C11H21NW |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+) |
| SMILES | [CH2-]C.[CH2-]N1CCC[C@]2(C[C@@H]2C)C1.[W+2] |
| InChI | InChI=1S/C9H16N.C2H5.W/c1-8-6-9(8)4-3-5-10(2)7-9;1-2;/h8H,2-7H2,1H3;1H2,2H3;/q2*-1;+2/t8-,9-;;/m0../s1 |
| InChIKey | XJYWFDHDPNLZGF-CDEWPDHBSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+)?
The IUPAC name of ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+) (CID 149229178) is ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+).
What is the SMILES notation for ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+)?
The canonical SMILES for ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+) is [CH2-]C.[CH2-]N1CCC[C@]2(C[C@@H]2C)C1.[W+2].
What is the InChIKey of ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+)?
The InChIKey is XJYWFDHDPNLZGF-CDEWPDHBSA-N. The full InChI is InChI=1S/C9H16N.C2H5.W/c1-8-6-9(8)4-3-5-10(2)7-9;1-2;/h8H,2-7H2,1H3;1H2,2H3;/q2*-1;+2/t8-,9-;;/m0../s1.
What are the key properties of ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+)?
ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+) has a molecular weight of 351.14 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2S,3R)-5-methanidyl-2-methyl-5-azaspiro[2.5]octane;tungsten(2+) is sourced from PubChem (CID 149229178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).