C26H24O5 — CID 149241356
6,7-bis[(4-methoxyphenyl)methoxy]-4H-naphthalen-1-one (PubChem CID 149241356) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is 6,7-bis[(4-methoxyphenyl)methoxy]-4H-naphthalen-1-one.
| Compound Name | 6,7-bis[(4-methoxyphenyl)methoxy]-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 149241356 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 6,7-bis[(4-methoxyphenyl)methoxy]-4H-naphthalen-1-one |
| SMILES | COc1ccc(COc2cc3c(cc2OCc2ccc(OC)cc2)C(=O)C=CC3)cc1 |
| InChI | InChI=1S/C26H24O5/c1-28-21-10-6-18(7-11-21)16-30-25-14-20-4-3-5-24(27)23(20)15-26(25)31-17-19-8-12-22(29-2)13-9-19/h3,5-15H,4,16-17H2,1-2H3 |
| InChIKey | XMGBVFHSCVIENI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |