C8H5N5 — CID 149253961
2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 149253961) has the molecular formula C8H5N5 and a molecular weight of 171.16 g/mol. Its IUPAC name is 2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 149253961 |
| Molecular Formula | C8H5N5 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | c1cc2c(cn1)cnc1ncnn12 |
| InChI | InChI=1S/C8H5N5/c1-2-9-3-6-4-10-8-11-5-12-13(8)7(1)6/h1-5H |
| InChIKey | AQBYSNGUHLGCRO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |