About 1-(dibromomethyl)pyrazolo[4,5-c]pyridine
1-(dibromomethyl)pyrazolo[4,5-c]pyridine (PubChem CID 175797957) has the molecular formula C7H5Br2N3
and a molecular weight of 290.95 g/mol. Its IUPAC name is 1-(dibromomethyl)pyrazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 1-(dibromomethyl)pyrazolo[4,5-c]pyridine |
| PubChem CID | 175797957 |
| Molecular Formula | C7H5Br2N3 |
| Molecular Weight | 290.95 g/mol |
| Exact Mass | 288.89 |
| IUPAC Name | 1-(dibromomethyl)pyrazolo[4,5-c]pyridine |
| SMILES | BrC(Br)n1ncc2cnccc21 |
| InChI | InChI=1S/C7H5Br2N3/c8-7(9)12-6-1-2-10-3-5(6)4-11-12/h1-4,7H |
| InChIKey | OBYSOQKZFYXABE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.95 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(dibromomethyl)pyrazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dibromomethyl)pyrazolo[4,5-c]pyridine?
The IUPAC name of 1-(dibromomethyl)pyrazolo[4,5-c]pyridine (CID 175797957) is 1-(dibromomethyl)pyrazolo[4,5-c]pyridine.
What is the SMILES notation for 1-(dibromomethyl)pyrazolo[4,5-c]pyridine?
The canonical SMILES for 1-(dibromomethyl)pyrazolo[4,5-c]pyridine is BrC(Br)n1ncc2cnccc21.
What is the InChIKey of 1-(dibromomethyl)pyrazolo[4,5-c]pyridine?
The InChIKey is OBYSOQKZFYXABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br2N3/c8-7(9)12-6-1-2-10-3-5(6)4-11-12/h1-4,7H.
What are the key properties of 1-(dibromomethyl)pyrazolo[4,5-c]pyridine?
1-(dibromomethyl)pyrazolo[4,5-c]pyridine has a molecular weight of 290.95 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dibromomethyl)pyrazolo[4,5-c]pyridine is sourced from PubChem (CID 175797957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).