C7H5Br2N3 — CID 175797957
1-(dibromomethyl)pyrazolo[4,5-c]pyridine (PubChem CID 175797957) has the molecular formula C7H5Br2N3 and a molecular weight of 290.95 g/mol. Its IUPAC name is 1-(dibromomethyl)pyrazolo[4,5-c]pyridine.
| Compound Name | 1-(dibromomethyl)pyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 175797957 |
| Molecular Formula | C7H5Br2N3 |
| Molecular Weight | 290.95 g/mol |
| Exact Mass | 288.89 |
| IUPAC Name | 1-(dibromomethyl)pyrazolo[4,5-c]pyridine |
| SMILES | BrC(Br)n1ncc2cnccc21 |
| InChI | InChI=1S/C7H5Br2N3/c8-7(9)12-6-1-2-10-3-5(6)4-11-12/h1-4,7H |
| InChIKey | OBYSOQKZFYXABE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.95 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|