C9H7N5 — CID 170405575
5-methyl-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene (PubChem CID 170405575) has the molecular formula C9H7N5 and a molecular weight of 185.19 g/mol. Its IUPAC name is 5-methyl-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene.
| Compound Name | 5-methyl-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
|---|---|
| PubChem CID | 170405575 |
| Molecular Formula | C9H7N5 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5-methyl-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
| SMILES | Cc1nnc2c3ccncc3cnn12 |
| InChI | InChI=1S/C9H7N5/c1-6-12-13-9-8-2-3-10-4-7(8)5-11-14(6)9/h2-5H,1H3 |
| InChIKey | UUFBBTPSIILTKT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |