C20H18N2O — CID 14925765
7-butyl-8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1,3,5(18),7,9,11,13,15-octaen-17-one (PubChem CID 14925765) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 7-butyl-8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1,3,5(18),7,9,11,13,15-octaen-17-one.
| Compound Name | 7-butyl-8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1,3,5(18),7,9,11,13,15-octaen-17-one |
|---|---|
| PubChem CID | 14925765 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 7-butyl-8,9-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1,3,5(18),7,9,11,13,15-octaen-17-one |
| SMILES | CCCCC1=NN=C2c3ccccc3C(=O)c3cccc(c32)C1 |
| InChI | InChI=1S/C20H18N2O/c1-2-3-8-14-12-13-7-6-11-17-18(13)19(22-21-14)15-9-4-5-10-16(15)20(17)23/h4-7,9-11H,2-3,8,12H2,1H3 |
| InChIKey | AKDRMVJVUGPNOP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|