C24H22F4N2OSi — CID 149258918
[(1R)-1-(2,4-difluorophenyl)-2,2-difluoro-1-isocyano-2-[5-(4-methylphenyl)-2-pyridinyl]ethoxy]-trimethylsilane (PubChem CID 149258918) has the molecular formula C24H22F4N2OSi and a molecular weight of 458.53 g/mol. Its IUPAC name is [(1R)-1-(2,4-difluorophenyl)-2,2-difluoro-1-isocyano-2-[5-(4-methylphenyl)-2-pyridinyl]ethoxy]-trimethylsilane.
| Compound Name | [(1R)-1-(2,4-difluorophenyl)-2,2-difluoro-1-isocyano-2-[5-(4-methylphenyl)-2-pyridinyl]ethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 149258918 |
| Molecular Formula | C24H22F4N2OSi |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [(1R)-1-(2,4-difluorophenyl)-2,2-difluoro-1-isocyano-2-[5-(4-methylphenyl)-2-pyridinyl]ethoxy]-trimethylsilane |
| SMILES | [C-]#[N+][C@@](O[Si](C)(C)C)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C24H22F4N2OSi/c1-16-6-8-17(9-7-16)18-10-13-22(30-15-18)23(27,28)24(29-2,31-32(3,4)5)20-12-11-19(25)14-21(20)26/h6-15H,1,3-5H3/t24-/m1/s1 |
| InChIKey | XOWAOYSBAYXNQB-XMMPIXPASA-N |
| XLogP | 7.05 |
| TPSA | 26.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|