C37H47N3O6 — CID 149260690
(2R)-N-[(2S,5R)-5-butyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-2-methyl-5-morpholin-4-yl-4-oxopentanamide (PubChem CID 149260690) has the molecular formula C37H47N3O6 and a molecular weight of 629.80 g/mol. Its IUPAC name is (2R)-N-[(2S,5R)-5-butyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-2-methyl-5-morpholin-4-yl-4-oxopentanamide.
| Compound Name | (2R)-N-[(2S,5R)-5-butyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-2-methyl-5-morpholin-4-yl-4-oxopentanamide |
|---|---|
| PubChem CID | 149260690 |
| Molecular Formula | C37H47N3O6 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | (2R)-N-[(2S,5R)-5-butyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-2-methyl-5-morpholin-4-yl-4-oxopentanamide |
| SMILES | CCCC[C@H](CC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](C)CC(=O)CN1CCOCC1)C(=O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C37H47N3O6/c1-3-4-12-28(36(44)34(42)16-15-27-10-6-5-7-11-27)23-35(43)33(22-29-24-38-32-14-9-8-13-31(29)32)39-37(45)26(2)21-30(41)25-40-17-19-46-20-18-40/h5-11,13-14,24,26,28,33,38H,3-4,12,15-23,25H2,1-2H3,(H,39,45)/t26-,28-,33+/m1/s1 |
| InChIKey | XPEGAGCFGNIQGZ-UHRJZISRSA-N |
| XLogP | 4.66 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|