C39H39N3O6 — CID 162026689
(2R)-N-[(2S,5R)-5-benzyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-2-methyl-4-(5-methyl-1,2-oxazol-3-yl)-4-oxobutanamide (PubChem CID 162026689) has the molecular formula C39H39N3O6 and a molecular weight of 645.76 g/mol. Its IUPAC name is (2R)-N-[(2S,5R)-5-benzyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-2-methyl-4-(5-methyl-1,2-oxazol-3-yl)-4-oxobutanamide.
| Compound Name | (2R)-N-[(2S,5R)-5-benzyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-2-methyl-4-(5-methyl-1,2-oxazol-3-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 162026689 |
| Molecular Formula | C39H39N3O6 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | (2R)-N-[(2S,5R)-5-benzyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-2-methyl-4-(5-methyl-1,2-oxazol-3-yl)-4-oxobutanamide |
| SMILES | Cc1cc(C(=O)C[C@@H](C)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)C[C@@H](Cc2ccccc2)C(=O)C(=O)CCc2ccccc2)no1 |
| InChI | InChI=1S/C39H39N3O6/c1-25(19-36(44)34-20-26(2)48-42-34)39(47)41-33(22-30-24-40-32-16-10-9-15-31(30)32)37(45)23-29(21-28-13-7-4-8-14-28)38(46)35(43)18-17-27-11-5-3-6-12-27/h3-16,20,24-25,29,33,40H,17-19,21-23H2,1-2H3,(H,41,47)/t25-,29-,33+/m1/s1 |
| InChIKey | YVLWVYXAYPHDGM-NPPOLANGSA-N |
| XLogP | 5.99 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|