C44H44N2O5 — CID 160909803
(2R)-N-[(2S,5R)-5-benzyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-4-(2,3-dihydro-1H-inden-2-yl)-2-methyl-4-oxobutanamide (PubChem CID 160909803) has the molecular formula C44H44N2O5 and a molecular weight of 680.85 g/mol. Its IUPAC name is (2R)-N-[(2S,5R)-5-benzyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-4-(2,3-dihydro-1H-inden-2-yl)-2-methyl-4-oxobutanamide.
| Compound Name | (2R)-N-[(2S,5R)-5-benzyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-4-(2,3-dihydro-1H-inden-2-yl)-2-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 160909803 |
| Molecular Formula | C44H44N2O5 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.33 |
| IUPAC Name | (2R)-N-[(2S,5R)-5-benzyl-1-(1H-indol-3-yl)-3,6,7-trioxo-9-phenylnonan-2-yl]-4-(2,3-dihydro-1H-inden-2-yl)-2-methyl-4-oxobutanamide |
| SMILES | C[C@H](CC(=O)C1Cc2ccccc2C1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)C[C@@H](Cc1ccccc1)C(=O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C44H44N2O5/c1-29(22-41(48)34-24-32-16-8-9-17-33(32)25-34)44(51)46-39(26-36-28-45-38-19-11-10-18-37(36)38)42(49)27-35(23-31-14-6-3-7-15-31)43(50)40(47)21-20-30-12-4-2-5-13-30/h2-19,28-29,34-35,39,45H,20-27H2,1H3,(H,46,51)/t29-,35-,39+/m1/s1 |
| InChIKey | SQPVSNXSAPNWDH-GPNSXGLGSA-N |
| XLogP | 6.79 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|