C32H25N4O+ — CID 149263725
2-[9-[3-[1-(3-methylimidazol-3-ium-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine (PubChem CID 149263725) has the molecular formula C32H25N4O+ and a molecular weight of 481.58 g/mol. Its IUPAC name is 2-[9-[3-[1-(3-methylimidazol-3-ium-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine.
| Compound Name | 2-[9-[3-[1-(3-methylimidazol-3-ium-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine |
|---|---|
| PubChem CID | 149263725 |
| Molecular Formula | C32H25N4O+ |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-[9-[3-[1-(3-methylimidazol-3-ium-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine |
| SMILES | C[n+]1ccn(-n2ccc(Oc3cccc(C4(c5ccccn5)c5ccccc5-c5ccccc54)c3)c2)c1 |
| InChI | InChI=1S/C32H25N4O/c1-34-19-20-36(23-34)35-18-16-26(22-35)37-25-10-8-9-24(21-25)32(31-15-6-7-17-33-31)29-13-4-2-11-27(29)28-12-3-5-14-30(28)32/h2-23H,1H3/q+1 |
| InChIKey | XPSVIKPMGOMSQV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|