C60H38N6Si — CID 149278610
2-(5',5'-diphenylspiro[acridine-9,10'-benzo[b][1]benzosiline]-10-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzene-1,4-dicarbonitrile (PubChem CID 149278610) has the molecular formula C60H38N6Si and a molecular weight of 871.09 g/mol. Its IUPAC name is 2-(5',5'-diphenylspiro[acridine-9,10'-benzo[b][1]benzosiline]-10-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzene-1,4-dicarbonitrile.
| Compound Name | 2-(5',5'-diphenylspiro[acridine-9,10'-benzo[b][1]benzosiline]-10-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 149278610 |
| Molecular Formula | C60H38N6Si |
| Molecular Weight | 871.09 g/mol |
| Exact Mass | 870.29 |
| IUPAC Name | 2-(5',5'-diphenylspiro[acridine-9,10'-benzo[b][1]benzosiline]-10-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(N2c3ccccc3C3(c4ccccc42)c2ccccc2[Si](c2ccccc2)(c2ccccc2)c2ccccc23)c(C#N)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C60H38N6Si/c61-39-43-38-54(44(40-62)37-47(43)59-64-57(41-21-5-1-6-22-41)63-58(65-59)42-23-7-2-8-24-42)66-52-33-17-13-29-48(52)60(49-30-14-18-34-53(49)66)50-31-15-19-35-55(50)67(45-25-9-3-10-26-45,46-27-11-4-12-28-46)56-36-20-16-32-51(56)60/h1-38H |
| InChIKey | XSMVVVOOVIBMAT-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.09 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|