C75H56N4Si3 — CID 162485349
[3-[4-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-6-phenyl-1,3,5-triazin-2-yl]-5-triphenylsilylphenyl]-triphenylsilane (PubChem CID 162485349) has the molecular formula C75H56N4Si3 and a molecular weight of 1097.56 g/mol. Its IUPAC name is [3-[4-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-6-phenyl-1,3,5-triazin-2-yl]-5-triphenylsilylphenyl]-triphenylsilane.
| Compound Name | [3-[4-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-6-phenyl-1,3,5-triazin-2-yl]-5-triphenylsilylphenyl]-triphenylsilane |
|---|---|
| PubChem CID | 162485349 |
| Molecular Formula | C75H56N4Si3 |
| Molecular Weight | 1097.56 g/mol |
| Exact Mass | 1096.38 |
| IUPAC Name | [3-[4-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-6-phenyl-1,3,5-triazin-2-yl]-5-triphenylsilylphenyl]-triphenylsilane |
| SMILES | c1ccc(-c2nc(-c3cc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)nc(N3c4ccccc4[Si](c4ccccc4)(c4ccccc4)c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C75H56N4Si3/c1-10-32-57(33-11-1)73-76-74(78-75(77-73)79-69-50-28-30-52-71(69)82(65-46-24-8-25-47-65,66-48-26-9-27-49-66)72-53-31-29-51-70(72)79)58-54-67(80(59-34-12-2-13-35-59,60-36-14-3-15-37-60)61-38-16-4-17-39-61)56-68(55-58)81(62-40-18-5-19-41-62,63-42-20-6-21-43-63)64-44-22-7-23-45-64/h1-56H |
| InChIKey | RJPXVNLKINEUDD-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.56 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|