C47H33N5Si — CID 163555880
[3-[4-(9H-acridin-10-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-(3-isocyanophenyl)-diphenylsilane (PubChem CID 163555880) has the molecular formula C47H33N5Si and a molecular weight of 695.90 g/mol. Its IUPAC name is [3-[4-(9H-acridin-10-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-(3-isocyanophenyl)-diphenylsilane.
| Compound Name | [3-[4-(9H-acridin-10-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-(3-isocyanophenyl)-diphenylsilane |
|---|---|
| PubChem CID | 163555880 |
| Molecular Formula | C47H33N5Si |
| Molecular Weight | 695.90 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | [3-[4-(9H-acridin-10-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-(3-isocyanophenyl)-diphenylsilane |
| SMILES | [C-]#[N+]c1cccc([Si](c2ccccc2)(c2ccccc2)c2cccc(-c3nc(-c4ccccc4)nc(N4c5ccccc5Cc5ccccc54)n3)c2)c1 |
| InChI | InChI=1S/C47H33N5Si/c1-48-38-22-16-28-42(33-38)53(39-23-7-3-8-24-39,40-25-9-4-10-26-40)41-27-15-21-37(32-41)46-49-45(34-17-5-2-6-18-34)50-47(51-46)52-43-29-13-11-19-35(43)31-36-20-12-14-30-44(36)52/h2-30,32-33H,31H2 |
| InChIKey | RWMPJYNYVPZAMG-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 46.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.90 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|