C54H37N5Si — CID 163774722
[3-[6-(9H-acridin-10-yl)-2-(3-isocyanocarbazol-9-yl)pyrimidin-4-yl]phenyl]-triphenylsilane (PubChem CID 163774722) has the molecular formula C54H37N5Si and a molecular weight of 784.01 g/mol. Its IUPAC name is [3-[6-(9H-acridin-10-yl)-2-(3-isocyanocarbazol-9-yl)pyrimidin-4-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[6-(9H-acridin-10-yl)-2-(3-isocyanocarbazol-9-yl)pyrimidin-4-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 163774722 |
| Molecular Formula | C54H37N5Si |
| Molecular Weight | 784.01 g/mol |
| Exact Mass | 783.28 |
| IUPAC Name | [3-[6-(9H-acridin-10-yl)-2-(3-isocyanocarbazol-9-yl)pyrimidin-4-yl]phenyl]-triphenylsilane |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1nc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)cc(N2c3ccccc3Cc3ccccc32)n1 |
| InChI | InChI=1S/C54H37N5Si/c1-55-41-32-33-52-47(36-41)46-28-13-16-31-51(46)59(52)54-56-48(37-53(57-54)58-49-29-14-11-18-39(49)34-40-19-12-15-30-50(40)58)38-20-17-27-45(35-38)60(42-21-5-2-6-22-42,43-23-7-3-8-24-43)44-25-9-4-10-26-44/h2-33,35-37H,34H2 |
| InChIKey | BJXYNLHBEXUYCX-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 38.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.01 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|