C14H15FN2O3 — CID 149281472
6-(2-fluoro-4-methylanilino)-3-imino-5-methoxyhex-5-ene-2,4-dione (PubChem CID 149281472) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 6-(2-fluoro-4-methylanilino)-3-imino-5-methoxyhex-5-ene-2,4-dione.
| Compound Name | 6-(2-fluoro-4-methylanilino)-3-imino-5-methoxyhex-5-ene-2,4-dione |
|---|---|
| PubChem CID | 149281472 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 6-(2-fluoro-4-methylanilino)-3-imino-5-methoxyhex-5-ene-2,4-dione |
| SMILES | [H]/N=C(\C(C)=O)C(=O)C(=CNc1ccc(C)cc1F)OC |
| InChI | InChI=1S/C14H15FN2O3/c1-8-4-5-11(10(15)6-8)17-7-12(20-3)14(19)13(16)9(2)18/h4-7,16-17H,1-3H3/b12-7?,16-13+ |
| InChIKey | XTAPEFYCGVKAIU-KUDOJORNSA-N |
| XLogP | 2.21 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|