C15H15BrN2O2 — CID 149293643
4-bromo-6,7,8,9-tetrahydro-5H-fluorene-1,7-dicarboxamide (PubChem CID 149293643) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 4-bromo-6,7,8,9-tetrahydro-5H-fluorene-1,7-dicarboxamide.
| Compound Name | 4-bromo-6,7,8,9-tetrahydro-5H-fluorene-1,7-dicarboxamide |
|---|---|
| PubChem CID | 149293643 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-bromo-6,7,8,9-tetrahydro-5H-fluorene-1,7-dicarboxamide |
| SMILES | NC(=O)c1ccc(Br)c2c1CC1=C2CCC(C(N)=O)C1 |
| InChI | InChI=1S/C15H15BrN2O2/c16-12-4-3-10(15(18)20)11-6-8-5-7(14(17)19)1-2-9(8)13(11)12/h3-4,7H,1-2,5-6H2,(H2,17,19)(H2,18,20) |
| InChIKey | XVIVIXSEUFCDBV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |