C10H11BrN2O — CID 130626632
(1S)-1-amino-7-bromo-2,3-dihydro-1H-indene-4-carboxamide (PubChem CID 130626632) has the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. Its IUPAC name is (1S)-1-amino-7-bromo-2,3-dihydro-1H-indene-4-carboxamide.
| Compound Name | (1S)-1-amino-7-bromo-2,3-dihydro-1H-indene-4-carboxamide |
|---|---|
| PubChem CID | 130626632 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | (1S)-1-amino-7-bromo-2,3-dihydro-1H-indene-4-carboxamide |
| SMILES | NC(=O)c1ccc(Br)c2c1CC[C@@H]2N |
| InChI | InChI=1S/C10H11BrN2O/c11-7-3-1-6(10(13)14)5-2-4-8(12)9(5)7/h1,3,8H,2,4,12H2,(H2,13,14)/t8-/m0/s1 |
| InChIKey | GQBOYRKDOYNBNY-QMMMGPOBSA-N |
| XLogP | 1.49 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |