C18H28 — CID 149312528
3,5,5,8,8-pentamethyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[b]naphthalene (PubChem CID 149312528) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 3,5,5,8,8-pentamethyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[b]naphthalene.
| Compound Name | 3,5,5,8,8-pentamethyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[b]naphthalene |
|---|---|
| PubChem CID | 149312528 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3,5,5,8,8-pentamethyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[b]naphthalene |
| SMILES | CC1CCC2C=C3C(=CC12)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C18H28/c1-12-6-7-13-10-15-16(11-14(12)13)18(4,5)9-8-17(15,2)3/h10-14H,6-9H2,1-5H3 |
| InChIKey | XYWUXRAYLMSBRN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |